C18H23NO — CID 70567665
2-(4-ethoxyphenyl)-N,N-diethylaniline (PubChem CID 70567665) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N,N-diethylaniline.
| Compound Name | 2-(4-ethoxyphenyl)-N,N-diethylaniline |
|---|---|
| PubChem CID | 70567665 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N,N-diethylaniline |
| SMILES | CCOc1ccc(-c2ccccc2N(CC)CC)cc1 |
| InChI | InChI=1S/C18H23NO/c1-4-19(5-2)18-10-8-7-9-17(18)15-11-13-16(14-12-15)20-6-3/h7-14H,4-6H2,1-3H3 |
| InChIKey | MZPDMBMRRRKBOI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |