C18H26N2 — CID 3028375
N,N,N'-triethyl-N'-naphthalen-1-ylethane-1,2-diamine (PubChem CID 3028375) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N,N,N'-triethyl-N'-naphthalen-1-ylethane-1,2-diamine.
| Compound Name | N,N,N'-triethyl-N'-naphthalen-1-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 3028375 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N,N,N'-triethyl-N'-naphthalen-1-ylethane-1,2-diamine |
| SMILES | CCN(CC)CCN(CC)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H26N2/c1-4-19(5-2)14-15-20(6-3)18-13-9-11-16-10-7-8-12-17(16)18/h7-13H,4-6,14-15H2,1-3H3 |
| InChIKey | URTGBXJXDXQZLA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |