C19H28N2 — CID 63467286
N'-ethyl-N-(2-methylpropyl)-N'-naphthalen-1-ylpropane-1,3-diamine (PubChem CID 63467286) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N'-ethyl-N-(2-methylpropyl)-N'-naphthalen-1-ylpropane-1,3-diamine.
| Compound Name | N'-ethyl-N-(2-methylpropyl)-N'-naphthalen-1-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63467286 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N'-ethyl-N-(2-methylpropyl)-N'-naphthalen-1-ylpropane-1,3-diamine |
| SMILES | CCN(CCCNCC(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H28N2/c1-4-21(14-8-13-20-15-16(2)3)19-12-7-10-17-9-5-6-11-18(17)19/h5-7,9-12,16,20H,4,8,13-15H2,1-3H3 |
| InChIKey | SQPMHIIQYUAPKK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|