C18H26N2 — CID 43095261
1-N-ethyl-4-methyl-1-N-naphthalen-1-ylpentane-1,2-diamine (PubChem CID 43095261) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-N-ethyl-4-methyl-1-N-naphthalen-1-ylpentane-1,2-diamine.
| Compound Name | 1-N-ethyl-4-methyl-1-N-naphthalen-1-ylpentane-1,2-diamine |
|---|---|
| PubChem CID | 43095261 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 1-N-ethyl-4-methyl-1-N-naphthalen-1-ylpentane-1,2-diamine |
| SMILES | CCN(CC(N)CC(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H26N2/c1-4-20(13-16(19)12-14(2)3)18-11-7-9-15-8-5-6-10-17(15)18/h5-11,14,16H,4,12-13,19H2,1-3H3 |
| InChIKey | WBZOAHSVGVQNDI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |