C14H23N — CID 18696135
N,N,2,3-tetraethylaniline (PubChem CID 18696135) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is N,N,2,3-tetraethylaniline.
| Compound Name | N,N,2,3-tetraethylaniline |
|---|---|
| PubChem CID | 18696135 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N,N,2,3-tetraethylaniline |
| SMILES | CCc1cccc(N(CC)CC)c1CC |
| InChI | InChI=1S/C14H23N/c1-5-12-10-9-11-14(13(12)6-2)15(7-3)8-4/h9-11H,5-8H2,1-4H3 |
| InChIKey | UNDRNFIUUWGOLT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |