C13H20ClN — CID 139534724
2-(chloromethyl)-N,N,6-triethylaniline (PubChem CID 139534724) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is 2-(chloromethyl)-N,N,6-triethylaniline.
| Compound Name | 2-(chloromethyl)-N,N,6-triethylaniline |
|---|---|
| PubChem CID | 139534724 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-(chloromethyl)-N,N,6-triethylaniline |
| SMILES | CCc1cccc(CCl)c1N(CC)CC |
| InChI | InChI=1S/C13H20ClN/c1-4-11-8-7-9-12(10-14)13(11)15(5-2)6-3/h7-9H,4-6,10H2,1-3H3 |
| InChIKey | FRKMDDUUWIEIPH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|