C14H28N2 — CID 142426314
ethane;3-ethyl-2-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 142426314) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;3-ethyl-2-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | ethane;3-ethyl-2-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 142426314 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | ethane;3-ethyl-2-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CC.CC.CCc1cccc(N)c1N(C)C |
| InChI | InChI=1S/C10H16N2.2C2H6/c1-4-8-6-5-7-9(11)10(8)12(2)3;2*1-2/h5-7H,4,11H2,1-3H3;2*1-2H3 |
| InChIKey | XMGNOHDNCGTTHJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|