C17H25N3 — CID 161139066
2-ethylaniline;1-N,2-N,2-N-trimethylbenzene-1,2-diamine (PubChem CID 161139066) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 2-ethylaniline;1-N,2-N,2-N-trimethylbenzene-1,2-diamine.
| Compound Name | 2-ethylaniline;1-N,2-N,2-N-trimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 161139066 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 2-ethylaniline;1-N,2-N,2-N-trimethylbenzene-1,2-diamine |
| SMILES | CCc1ccccc1N.CNc1ccccc1N(C)C |
| InChI | InChI=1S/C9H14N2.C8H11N/c1-10-8-6-4-5-7-9(8)11(2)3;1-2-7-5-3-4-6-8(7)9/h4-7,10H,1-3H3;3-6H,2,9H2,1H3 |
| InChIKey | UNENAYQBBATLBW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|