C9H14N2 — CID 533455
1-N,2-N,2-N-trimethylbenzene-1,2-diamine (PubChem CID 533455) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-N,2-N,2-N-trimethylbenzene-1,2-diamine.
| Compound Name | 1-N,2-N,2-N-trimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 533455 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1-N,2-N,2-N-trimethylbenzene-1,2-diamine |
| SMILES | CNc1ccccc1N(C)C |
| InChI | InChI=1S/C9H14N2/c1-10-8-6-4-5-7-9(8)11(2)3/h4-7,10H,1-3H3 |
| InChIKey | BXBFTMKSQSKHMF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |