C16H22N4 — CID 141340029
3-[anilino(methyl)amino]-1-N,2-N,2-N-trimethylbenzene-1,2-diamine (PubChem CID 141340029) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-[anilino(methyl)amino]-1-N,2-N,2-N-trimethylbenzene-1,2-diamine.
| Compound Name | 3-[anilino(methyl)amino]-1-N,2-N,2-N-trimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 141340029 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3-[anilino(methyl)amino]-1-N,2-N,2-N-trimethylbenzene-1,2-diamine |
| SMILES | CNc1cccc(N(C)Nc2ccccc2)c1N(C)C |
| InChI | InChI=1S/C16H22N4/c1-17-14-11-8-12-15(16(14)19(2)3)20(4)18-13-9-6-5-7-10-13/h5-12,17-18H,1-4H3 |
| InChIKey | KCYNACFREFJPLO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|