C16H23N5 — CID 154369247
4-[anilino(methyl)amino]-2-N,3-N,3-N-trimethylbenzene-1,2,3-triamine (PubChem CID 154369247) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[anilino(methyl)amino]-2-N,3-N,3-N-trimethylbenzene-1,2,3-triamine.
| Compound Name | 4-[anilino(methyl)amino]-2-N,3-N,3-N-trimethylbenzene-1,2,3-triamine |
|---|---|
| PubChem CID | 154369247 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 4-[anilino(methyl)amino]-2-N,3-N,3-N-trimethylbenzene-1,2,3-triamine |
| SMILES | CNc1c(N)ccc(N(C)Nc2ccccc2)c1N(C)C |
| InChI | InChI=1S/C16H23N5/c1-18-15-13(17)10-11-14(16(15)20(2)3)21(4)19-12-8-6-5-7-9-12/h5-11,18-19H,17H2,1-4H3 |
| InChIKey | RUNSYHJSGNUBQW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 56.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|