C11H17N3S — CID 54120941
1,1,3-trimethyl-3-[2-(methylamino)phenyl]thiourea (PubChem CID 54120941) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 1,1,3-trimethyl-3-[2-(methylamino)phenyl]thiourea.
| Compound Name | 1,1,3-trimethyl-3-[2-(methylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 54120941 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1,1,3-trimethyl-3-[2-(methylamino)phenyl]thiourea |
| SMILES | CNc1ccccc1N(C)C(=S)N(C)C |
| InChI | InChI=1S/C11H17N3S/c1-12-9-7-5-6-8-10(9)14(4)11(15)13(2)3/h5-8,12H,1-4H3 |
| InChIKey | BZPOGFGUELHOQB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|