C13H22N2 — CID 28772957
N'-ethyl-N'-(2-ethylphenyl)propane-1,3-diamine (PubChem CID 28772957) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N'-ethyl-N'-(2-ethylphenyl)propane-1,3-diamine.
| Compound Name | N'-ethyl-N'-(2-ethylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 28772957 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N'-ethyl-N'-(2-ethylphenyl)propane-1,3-diamine |
| SMILES | CCc1ccccc1N(CC)CCCN |
| InChI | InChI=1S/C13H22N2/c1-3-12-8-5-6-9-13(12)15(4-2)11-7-10-14/h5-6,8-9H,3-4,7,10-11,14H2,1-2H3 |
| InChIKey | IBJDDSMXBSXEPL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |