C11H18N2 — CID 28772630
N'-(2-ethylphenyl)-N'-methylethane-1,2-diamine (PubChem CID 28772630) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N'-(2-ethylphenyl)-N'-methylethane-1,2-diamine.
| Compound Name | N'-(2-ethylphenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 28772630 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N'-(2-ethylphenyl)-N'-methylethane-1,2-diamine |
| SMILES | CCc1ccccc1N(C)CCN |
| InChI | InChI=1S/C11H18N2/c1-3-10-6-4-5-7-11(10)13(2)9-8-12/h4-7H,3,8-9,12H2,1-2H3 |
| InChIKey | RIGYQNWSSXFDGA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |