C11H16F2N2 — CID 28792510
N'-(2,6-difluorophenyl)-N'-ethylpropane-1,3-diamine (PubChem CID 28792510) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is N'-(2,6-difluorophenyl)-N'-ethylpropane-1,3-diamine.
| Compound Name | N'-(2,6-difluorophenyl)-N'-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 28792510 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N'-(2,6-difluorophenyl)-N'-ethylpropane-1,3-diamine |
| SMILES | CCN(CCCN)c1c(F)cccc1F |
| InChI | InChI=1S/C11H16F2N2/c1-2-15(8-4-7-14)11-9(12)5-3-6-10(11)13/h3,5-6H,2,4,7-8,14H2,1H3 |
| InChIKey | NSPKBUIOBQWPNJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |