C31H48AuN2Si-2 — CID 138962595
1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-2-ide;gold;methanidyl(trimethyl)silane (PubChem CID 138962595) has the molecular formula C31H48AuN2Si-2 and a molecular weight of 673.79 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-2-ide;gold;methanidyl(trimethyl)silane.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-2-ide;gold;methanidyl(trimethyl)silane |
|---|---|
| PubChem CID | 138962595 |
| Molecular Formula | C31H48AuN2Si-2 |
| Molecular Weight | 673.79 g/mol |
| Exact Mass | 673.33 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)phenyl]-2H-imidazol-2-ide;gold;methanidyl(trimethyl)silane |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C=CN(c2c(C(C)C)cccc2C(C)C)[CH-]1.[Au].[CH2-][Si](C)(C)C |
| InChI | InChI=1S/C27H37N2.C4H11Si.Au/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-5(2,3)4;/h9-21H,1-8H3;1H2,2-4H3;/q2*-1; |
| InChIKey | IPCLXYTYZNPCBO-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.79 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|