C36H28N2Pd — CID 175030395
[4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium (PubChem CID 175030395) has the molecular formula C36H28N2Pd and a molecular weight of 595.05 g/mol. Its IUPAC name is [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium.
| Compound Name | [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium |
|---|---|
| PubChem CID | 175030395 |
| Molecular Formula | C36H28N2Pd |
| Molecular Weight | 595.05 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium |
| SMILES | Cc1cc(C(c2ccccc2)c2ccccc2)c(C2=NC(=[Pd])N=C2)c(C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C36H28N2.Pd/c1-26-22-31(34(27-14-6-2-7-15-27)28-16-8-3-9-17-28)36(33-24-37-25-38-33)32(23-26)35(29-18-10-4-11-19-29)30-20-12-5-13-21-30;/h2-24,34-35H,1H3; |
| InChIKey | NFBYWCYIQCYBPV-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.05 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|