About [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium
[4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium (PubChem CID 175030395) has the molecular formula C36H28N2Pd
and a molecular weight of 595.05 g/mol. Its IUPAC name is [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium.
Molecular Properties
| Compound Name | [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium |
| PubChem CID | 175030395 |
| Molecular Formula | C36H28N2Pd |
| Molecular Weight | 595.05 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium |
| SMILES | Cc1cc(C(c2ccccc2)c2ccccc2)c(C2=NC(=[Pd])N=C2)c(C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C36H28N2.Pd/c1-26-22-31(34(27-14-6-2-7-15-27)28-16-8-3-9-17-28)36(33-24-37-25-38-33)32(23-26)35(29-18-10-4-11-19-29)30-20-12-5-13-21-30;/h2-24,34-35H,1H3; |
| InChIKey | NFBYWCYIQCYBPV-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.05 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium?
The IUPAC name of [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium (CID 175030395) is [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium.
What is the SMILES notation for [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium?
The canonical SMILES for [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium is Cc1cc(C(c2ccccc2)c2ccccc2)c(C2=NC(=[Pd])N=C2)c(C(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium?
The InChIKey is NFBYWCYIQCYBPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H28N2.Pd/c1-26-22-31(34(27-14-6-2-7-15-27)28-16-8-3-9-17-28)36(33-24-37-25-38-33)32(23-26)35(29-18-10-4-11-19-29)30-20-12-5-13-21-30;/h2-24,34-35H,1H3;.
What are the key properties of [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium?
[4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium has a molecular weight of 595.05 g/mol, XLogP of 7.86, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,6-dibenzhydryl-4-methylphenyl)imidazol-2-ylidene]palladium is sourced from PubChem (CID 175030395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).