C25H33N2O2+ — CID 141382552
1,3-bis(2,6-dimethyl-4-propan-2-yloxyphenyl)imidazol-1-ium (PubChem CID 141382552) has the molecular formula C25H33N2O2+ and a molecular weight of 393.55 g/mol. Its IUPAC name is 1,3-bis(2,6-dimethyl-4-propan-2-yloxyphenyl)imidazol-1-ium.
| Compound Name | 1,3-bis(2,6-dimethyl-4-propan-2-yloxyphenyl)imidazol-1-ium |
|---|---|
| PubChem CID | 141382552 |
| Molecular Formula | C25H33N2O2+ |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 1,3-bis(2,6-dimethyl-4-propan-2-yloxyphenyl)imidazol-1-ium |
| SMILES | Cc1cc(OC(C)C)cc(C)c1-n1cc[n+](-c2c(C)cc(OC(C)C)cc2C)c1 |
| InChI | InChI=1S/C25H33N2O2/c1-16(2)28-22-11-18(5)24(19(6)12-22)26-9-10-27(15-26)25-20(7)13-23(14-21(25)8)29-17(3)4/h9-17H,1-8H3/q+1 |
| InChIKey | ATJAYBLNGIBUKI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|