C9H10Br2O — CID 50998234
1,3-dibromo-5-propan-2-yloxybenzene (PubChem CID 50998234) has the molecular formula C9H10Br2O and a molecular weight of 293.99 g/mol. Its IUPAC name is 1,3-dibromo-5-propan-2-yloxybenzene.
| Compound Name | 1,3-dibromo-5-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 50998234 |
| Molecular Formula | C9H10Br2O |
| Molecular Weight | 293.99 g/mol |
| Exact Mass | 291.91 |
| IUPAC Name | 1,3-dibromo-5-propan-2-yloxybenzene |
| SMILES | CC(C)Oc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C9H10Br2O/c1-6(2)12-9-4-7(10)3-8(11)5-9/h3-6H,1-2H3 |
| InChIKey | YEANGEKXRPNJTL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.99 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |