About 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate
3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate (PubChem CID 158388681) has the molecular formula C18H18Br2O6
and a molecular weight of 490.14 g/mol. Its IUPAC name is 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate.
Molecular Properties
| Compound Name | 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate |
| PubChem CID | 158388681 |
| Molecular Formula | C18H18Br2O6 |
| Molecular Weight | 490.14 g/mol |
| Exact Mass | 487.95 |
| IUPAC Name | 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate |
| SMILES | COC(=O)c1cc(Br)cc(OC(C)C)c1.O=C(O)c1cc(O)cc(Br)c1 |
| InChI | InChI=1S/C11H13BrO3.C7H5BrO3/c1-7(2)15-10-5-8(11(13)14-3)4-9(12)6-10;8-5-1-4(7(10)11)2-6(9)3-5/h4-7H,1-3H3;1-3,9H,(H,10,11) |
| InChIKey | GWRDWXZYWBAAQR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.14 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate?
The IUPAC name of 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate (CID 158388681) is 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate.
What is the SMILES notation for 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate?
The canonical SMILES for 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate is COC(=O)c1cc(Br)cc(OC(C)C)c1.O=C(O)c1cc(O)cc(Br)c1.
What is the InChIKey of 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate?
The InChIKey is GWRDWXZYWBAAQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO3.C7H5BrO3/c1-7(2)15-10-5-8(11(13)14-3)4-9(12)6-10;8-5-1-4(7(10)11)2-6(9)3-5/h4-7H,1-3H3;1-3,9H,(H,10,11).
What are the key properties of 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate?
3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate has a molecular weight of 490.14 g/mol, XLogP of 4.88, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-hydroxybenzoic acid;methyl 3-bromo-5-propan-2-yloxybenzoate is sourced from PubChem (CID 158388681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).