C30H29NO2S — CID 19753031
N-(2,6-dimethylphenyl)-4-(4-hydroxy-3,5-diphenylphenyl)sulfanylbutanamide (PubChem CID 19753031) has the molecular formula C30H29NO2S and a molecular weight of 467.63 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-(4-hydroxy-3,5-diphenylphenyl)sulfanylbutanamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-(4-hydroxy-3,5-diphenylphenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 19753031 |
| Molecular Formula | C30H29NO2S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-(4-hydroxy-3,5-diphenylphenyl)sulfanylbutanamide |
| SMILES | Cc1cccc(C)c1NC(=O)CCCSc1cc(-c2ccccc2)c(O)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C30H29NO2S/c1-21-11-9-12-22(2)29(21)31-28(32)17-10-18-34-25-19-26(23-13-5-3-6-14-23)30(33)27(20-25)24-15-7-4-8-16-24/h3-9,11-16,19-20,33H,10,17-18H2,1-2H3,(H,31,32) |
| InChIKey | WYBMVYBDFBZYSB-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|