C20H35NO2S — CID 3076001
2-[1-(dimethylamino)-3-methylbutan-2-yl]-5-heptylsulfanylbenzene-1,4-diol (PubChem CID 3076001) has the molecular formula C20H35NO2S and a molecular weight of 353.57 g/mol. Its IUPAC name is 2-[1-(dimethylamino)-3-methylbutan-2-yl]-5-heptylsulfanylbenzene-1,4-diol.
| Compound Name | 2-[1-(dimethylamino)-3-methylbutan-2-yl]-5-heptylsulfanylbenzene-1,4-diol |
|---|---|
| PubChem CID | 3076001 |
| Molecular Formula | C20H35NO2S |
| Molecular Weight | 353.57 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 2-[1-(dimethylamino)-3-methylbutan-2-yl]-5-heptylsulfanylbenzene-1,4-diol |
| SMILES | CCCCCCCSc1cc(O)c(C(CN(C)C)C(C)C)cc1O |
| InChI | InChI=1S/C20H35NO2S/c1-6-7-8-9-10-11-24-20-13-18(22)16(12-19(20)23)17(15(2)3)14-21(4)5/h12-13,15,17,22-23H,6-11,14H2,1-5H3 |
| InChIKey | GMXVDSLOWPDGPW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|