C18H12F4O4 — CID 139704040
5-(2-ethoxyethyl)-1,2,3,4-tetrafluoro-8-hydroxyanthracene-9,10-dione (PubChem CID 139704040) has the molecular formula C18H12F4O4 and a molecular weight of 368.28 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-1,2,3,4-tetrafluoro-8-hydroxyanthracene-9,10-dione.
| Compound Name | 5-(2-ethoxyethyl)-1,2,3,4-tetrafluoro-8-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 139704040 |
| Molecular Formula | C18H12F4O4 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 5-(2-ethoxyethyl)-1,2,3,4-tetrafluoro-8-hydroxyanthracene-9,10-dione |
| SMILES | CCOCCc1ccc(O)c2c1C(=O)c1c(F)c(F)c(F)c(F)c1C2=O |
| InChI | InChI=1S/C18H12F4O4/c1-2-26-6-5-7-3-4-8(23)10-9(7)17(24)11-12(18(10)25)14(20)16(22)15(21)13(11)19/h3-4,23H,2,5-6H2,1H3 |
| InChIKey | FOROEDXULFGSAP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|