C22H25BrN2O4 — CID 90068729
1-amino-2-bromo-4,8-dihydroxy-5-(octylamino)anthracene-9,10-dione (PubChem CID 90068729) has the molecular formula C22H25BrN2O4 and a molecular weight of 461.36 g/mol. Its IUPAC name is 1-amino-2-bromo-4,8-dihydroxy-5-(octylamino)anthracene-9,10-dione.
| Compound Name | 1-amino-2-bromo-4,8-dihydroxy-5-(octylamino)anthracene-9,10-dione |
|---|---|
| PubChem CID | 90068729 |
| Molecular Formula | C22H25BrN2O4 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-amino-2-bromo-4,8-dihydroxy-5-(octylamino)anthracene-9,10-dione |
| SMILES | CCCCCCCCNc1ccc(O)c2c1C(=O)c1c(O)cc(Br)c(N)c1C2=O |
| InChI | InChI=1S/C22H25BrN2O4/c1-2-3-4-5-6-7-10-25-13-8-9-14(26)17-16(13)21(28)18-15(27)11-12(23)20(24)19(18)22(17)29/h8-9,11,25-27H,2-7,10,24H2,1H3 |
| InChIKey | CQTBHQOYHTWJNL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|