C52H70FN3O4 — CID 18970750
1,2-bis[2,6-bis(2-methylpropyl)-N-propylanilino]-3-(butylamino)-4-fluoro-5,8-dihydroxyanthracene-9,10-dione (PubChem CID 18970750) has the molecular formula C52H70FN3O4 and a molecular weight of 820.15 g/mol. Its IUPAC name is 1,2-bis[2,6-bis(2-methylpropyl)-N-propylanilino]-3-(butylamino)-4-fluoro-5,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 1,2-bis[2,6-bis(2-methylpropyl)-N-propylanilino]-3-(butylamino)-4-fluoro-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 18970750 |
| Molecular Formula | C52H70FN3O4 |
| Molecular Weight | 820.15 g/mol |
| Exact Mass | 819.54 |
| IUPAC Name | 1,2-bis[2,6-bis(2-methylpropyl)-N-propylanilino]-3-(butylamino)-4-fluoro-5,8-dihydroxyanthracene-9,10-dione |
| SMILES | CCCCNc1c(F)c2c(c(N(CCC)c3c(CC(C)C)cccc3CC(C)C)c1N(CCC)c1c(CC(C)C)cccc1CC(C)C)C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C52H70FN3O4/c1-12-15-24-54-46-45(53)43-44(52(60)42-40(58)23-22-39(57)41(42)51(43)59)49(55(25-13-2)47-35(27-31(4)5)18-16-19-36(47)28-32(6)7)50(46)56(26-14-3)48-37(29-33(8)9)20-17-21-38(48)30-34(10)11/h16-23,31-34,54,57-58H,12-15,24-30H2,1-11H3 |
| InChIKey | SOIMNYXZZOVZSL-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.15 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|