C33H36FNO8 — CID 139891422
butyl 3-[(3,4-dibutoxy-1-fluoro-5,8-dihydroxy-9,10-dioxoanthracen-2-yl)amino]benzoate (PubChem CID 139891422) has the molecular formula C33H36FNO8 and a molecular weight of 593.65 g/mol. Its IUPAC name is butyl 3-[(3,4-dibutoxy-1-fluoro-5,8-dihydroxy-9,10-dioxoanthracen-2-yl)amino]benzoate.
| Compound Name | butyl 3-[(3,4-dibutoxy-1-fluoro-5,8-dihydroxy-9,10-dioxoanthracen-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 139891422 |
| Molecular Formula | C33H36FNO8 |
| Molecular Weight | 593.65 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | butyl 3-[(3,4-dibutoxy-1-fluoro-5,8-dihydroxy-9,10-dioxoanthracen-2-yl)amino]benzoate |
| SMILES | CCCCOC(=O)c1cccc(Nc2c(F)c3c(c(OCCCC)c2OCCCC)C(=O)c2c(O)ccc(O)c2C3=O)c1 |
| InChI | InChI=1S/C33H36FNO8/c1-4-7-15-41-31-26-25(29(38)23-21(36)13-14-22(37)24(23)30(26)39)27(34)28(32(31)42-16-8-5-2)35-20-12-10-11-19(18-20)33(40)43-17-9-6-3/h10-14,18,35-37H,4-9,15-17H2,1-3H3 |
| InChIKey | UAMAREPGDKZRQJ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.65 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|