C29H19F2NO6S — CID 18970707
ethyl 3-[(1,4-difluoro-5,8-dihydroxy-9,10-dioxo-3-phenylsulfanylanthracen-2-yl)amino]benzoate (PubChem CID 18970707) has the molecular formula C29H19F2NO6S and a molecular weight of 547.54 g/mol. Its IUPAC name is ethyl 3-[(1,4-difluoro-5,8-dihydroxy-9,10-dioxo-3-phenylsulfanylanthracen-2-yl)amino]benzoate.
| Compound Name | ethyl 3-[(1,4-difluoro-5,8-dihydroxy-9,10-dioxo-3-phenylsulfanylanthracen-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 18970707 |
| Molecular Formula | C29H19F2NO6S |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | ethyl 3-[(1,4-difluoro-5,8-dihydroxy-9,10-dioxo-3-phenylsulfanylanthracen-2-yl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2c(F)c3c(c(F)c2Sc2ccccc2)C(=O)c2c(O)ccc(O)c2C3=O)c1 |
| InChI | InChI=1S/C29H19F2NO6S/c1-2-38-29(37)14-7-6-8-15(13-14)32-25-23(30)21-22(24(31)28(25)39-16-9-4-3-5-10-16)27(36)20-18(34)12-11-17(33)19(20)26(21)35/h3-13,32-34H,2H2,1H3 |
| InChIKey | PQOHZKCKXSIFBM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|