C21H19NO4 — CID 22550510
ethyl 3-[[2-(3,4-dimethylphenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate (PubChem CID 22550510) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is ethyl 3-[[2-(3,4-dimethylphenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate.
| Compound Name | ethyl 3-[[2-(3,4-dimethylphenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate |
|---|---|
| PubChem CID | 22550510 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | ethyl 3-[[2-(3,4-dimethylphenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2c(-c3ccc(C)c(C)c3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C21H19NO4/c1-4-26-21(25)15-6-5-7-16(11-15)22-18-17(19(23)20(18)24)14-9-8-12(2)13(3)10-14/h5-11,22H,4H2,1-3H3 |
| InChIKey | GCUASGXLOWSYTK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|