C20H17NO4 — CID 126459405
ethyl 4-[[2-(4-methylphenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate (PubChem CID 126459405) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is ethyl 4-[[2-(4-methylphenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(4-methylphenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate |
|---|---|
| PubChem CID | 126459405 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | ethyl 4-[[2-(4-methylphenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2c(-c3ccc(C)cc3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C20H17NO4/c1-3-25-20(24)14-8-10-15(11-9-14)21-17-16(18(22)19(17)23)13-6-4-12(2)5-7-13/h4-11,21H,3H2,1-2H3 |
| InChIKey | XVHRVOIVASSVKP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|