C18H12ClNO4 — CID 20917329
methyl 4-[[2-(4-chlorophenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate (PubChem CID 20917329) has the molecular formula C18H12ClNO4 and a molecular weight of 341.75 g/mol. Its IUPAC name is methyl 4-[[2-(4-chlorophenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate.
| Compound Name | methyl 4-[[2-(4-chlorophenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate |
|---|---|
| PubChem CID | 20917329 |
| Molecular Formula | C18H12ClNO4 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | methyl 4-[[2-(4-chlorophenyl)-3,4-dioxocyclobuten-1-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2c(-c3ccc(Cl)cc3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C18H12ClNO4/c1-24-18(23)11-4-8-13(9-5-11)20-15-14(16(21)17(15)22)10-2-6-12(19)7-3-10/h2-9,20H,1H3 |
| InChIKey | LJBZGCFLPVIDCS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|