C23H19N2O6- — CID 3511141
3,4-bis[(2-phenoxyacetyl)amino]benzoate (PubChem CID 3511141) has the molecular formula C23H19N2O6- and a molecular weight of 419.41 g/mol. Its IUPAC name is 3,4-bis[(2-phenoxyacetyl)amino]benzoate.
| Compound Name | 3,4-bis[(2-phenoxyacetyl)amino]benzoate |
|---|---|
| PubChem CID | 3511141 |
| Molecular Formula | C23H19N2O6- |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3,4-bis[(2-phenoxyacetyl)amino]benzoate |
| SMILES | O=C(COc1ccccc1)Nc1ccc(C(=O)[O-])cc1NC(=O)COc1ccccc1 |
| InChI | InChI=1S/C23H20N2O6/c26-21(14-30-17-7-3-1-4-8-17)24-19-12-11-16(23(28)29)13-20(19)25-22(27)15-31-18-9-5-2-6-10-18/h1-13H,14-15H2,(H,24,26)(H,25,27)(H,28,29)/p-1 |
| InChIKey | VOYFQOQBMZFZKN-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 116.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |