C15H11FNO4- — CID 6933601
2-fluoro-6-[(2-phenoxyacetyl)amino]benzoate (PubChem CID 6933601) has the molecular formula C15H11FNO4- and a molecular weight of 288.25 g/mol. Its IUPAC name is 2-fluoro-6-[(2-phenoxyacetyl)amino]benzoate.
| Compound Name | 2-fluoro-6-[(2-phenoxyacetyl)amino]benzoate |
|---|---|
| PubChem CID | 6933601 |
| Molecular Formula | C15H11FNO4- |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-fluoro-6-[(2-phenoxyacetyl)amino]benzoate |
| SMILES | O=C(COc1ccccc1)Nc1cccc(F)c1C(=O)[O-] |
| InChI | InChI=1S/C15H12FNO4/c16-11-7-4-8-12(14(11)15(19)20)17-13(18)9-21-10-5-2-1-3-6-10/h1-8H,9H2,(H,17,18)(H,19,20)/p-1 |
| InChIKey | MKNXWHPIWWLAKN-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |