C15H19N2O4- — CID 6949578
3,4-bis(2-methylpropanoylamino)benzoate (PubChem CID 6949578) has the molecular formula C15H19N2O4- and a molecular weight of 291.33 g/mol. Its IUPAC name is 3,4-bis(2-methylpropanoylamino)benzoate.
| Compound Name | 3,4-bis(2-methylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 6949578 |
| Molecular Formula | C15H19N2O4- |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3,4-bis(2-methylpropanoylamino)benzoate |
| SMILES | CC(C)C(=O)Nc1ccc(C(=O)[O-])cc1NC(=O)C(C)C |
| InChI | InChI=1S/C15H20N2O4/c1-8(2)13(18)16-11-6-5-10(15(20)21)7-12(11)17-14(19)9(3)4/h5-9H,1-4H3,(H,16,18)(H,17,19)(H,20,21)/p-1 |
| InChIKey | QFSNMFBLRXRHGH-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |