C12H14NO3- — CID 22303277
2-methyl-4-(2-methylpropanoylamino)benzoate (PubChem CID 22303277) has the molecular formula C12H14NO3- and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-methyl-4-(2-methylpropanoylamino)benzoate.
| Compound Name | 2-methyl-4-(2-methylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 22303277 |
| Molecular Formula | C12H14NO3- |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-methyl-4-(2-methylpropanoylamino)benzoate |
| SMILES | Cc1cc(NC(=O)C(C)C)ccc1C(=O)[O-] |
| InChI | InChI=1S/C12H15NO3/c1-7(2)11(14)13-9-4-5-10(12(15)16)8(3)6-9/h4-7H,1-3H3,(H,13,14)(H,15,16)/p-1 |
| InChIKey | VBLDZCITTQCJKW-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |