C23H12NO7- — CID 2185642
4-[2-(1,3-benzodioxol-5-yl)-1,3-dioxoisoindole-5-carbonyl]benzoate (PubChem CID 2185642) has the molecular formula C23H12NO7- and a molecular weight of 414.35 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-1,3-dioxoisoindole-5-carbonyl]benzoate.
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-1,3-dioxoisoindole-5-carbonyl]benzoate |
|---|---|
| PubChem CID | 2185642 |
| Molecular Formula | C23H12NO7- |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-1,3-dioxoisoindole-5-carbonyl]benzoate |
| SMILES | O=C([O-])c1ccc(C(=O)c2ccc3c(c2)C(=O)N(c2ccc4c(c2)OCO4)C3=O)cc1 |
| InChI | InChI=1S/C23H13NO7/c25-20(12-1-3-13(4-2-12)23(28)29)14-5-7-16-17(9-14)22(27)24(21(16)26)15-6-8-18-19(10-15)31-11-30-18/h1-10H,11H2,(H,28,29)/p-1 |
| InChIKey | DLYXDTALDNMUCC-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|