C22H14ClFN2O3 — CID 9146369
N-(3-chloro-2-fluorophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide (PubChem CID 9146369) has the molecular formula C22H14ClFN2O3 and a molecular weight of 408.82 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide.
| Compound Name | N-(3-chloro-2-fluorophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 9146369 |
| Molecular Formula | C22H14ClFN2O3 |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1F)c1cccc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C22H14ClFN2O3/c23-17-9-4-10-18(19(17)24)25-20(27)14-6-3-5-13(11-14)12-26-21(28)15-7-1-2-8-16(15)22(26)29/h1-11H,12H2,(H,25,27) |
| InChIKey | YHNLIXQIICFZND-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|