C20H28N2O4S — CID 8515821
2-(1-adamantyl)-N'-(2-methoxy-5-methylphenyl)sulfonylacetohydrazide (PubChem CID 8515821) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-(1-adamantyl)-N'-(2-methoxy-5-methylphenyl)sulfonylacetohydrazide.
| Compound Name | 2-(1-adamantyl)-N'-(2-methoxy-5-methylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8515821 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-(1-adamantyl)-N'-(2-methoxy-5-methylphenyl)sulfonylacetohydrazide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H28N2O4S/c1-13-3-4-17(26-2)18(5-13)27(24,25)22-21-19(23)12-20-9-14-6-15(10-20)8-16(7-14)11-20/h3-5,14-16,22H,6-12H2,1-2H3,(H,21,23) |
| InChIKey | QROZASSRXLUASU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|