C12H10ClFN4O4S2 — CID 8860900
N'-(4-chloro-2-fluorophenyl)sulfonyl-2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetohydrazide (PubChem CID 8860900) has the molecular formula C12H10ClFN4O4S2 and a molecular weight of 392.82 g/mol. Its IUPAC name is N'-(4-chloro-2-fluorophenyl)sulfonyl-2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetohydrazide.
| Compound Name | N'-(4-chloro-2-fluorophenyl)sulfonyl-2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetohydrazide |
|---|---|
| PubChem CID | 8860900 |
| Molecular Formula | C12H10ClFN4O4S2 |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | N'-(4-chloro-2-fluorophenyl)sulfonyl-2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetohydrazide |
| SMILES | O=C(Cc1cc(=O)[nH]c(=S)[nH]1)NNS(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H10ClFN4O4S2/c13-6-1-2-9(8(14)3-6)24(21,22)18-17-11(20)5-7-4-10(19)16-12(23)15-7/h1-4,18H,5H2,(H,17,20)(H2,15,16,19,23) |
| InChIKey | NXUNPXXFZMXDSS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|