C14H11ClF2N2O3S2 — CID 9237149
2-(4-chlorophenyl)sulfanyl-N'-(2,5-difluorophenyl)sulfonylacetohydrazide (PubChem CID 9237149) has the molecular formula C14H11ClF2N2O3S2 and a molecular weight of 392.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N'-(2,5-difluorophenyl)sulfonylacetohydrazide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N'-(2,5-difluorophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 9237149 |
| Molecular Formula | C14H11ClF2N2O3S2 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N'-(2,5-difluorophenyl)sulfonylacetohydrazide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NNS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H11ClF2N2O3S2/c15-9-1-4-11(5-2-9)23-8-14(20)18-19-24(21,22)13-7-10(16)3-6-12(13)17/h1-7,19H,8H2,(H,18,20) |
| InChIKey | RMZGDTZPNPKYOH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|