C15H11Cl4N3O2S — CID 134102372
1-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-3-(2,4,6-trichlorophenyl)urea (PubChem CID 134102372) has the molecular formula C15H11Cl4N3O2S and a molecular weight of 439.15 g/mol. Its IUPAC name is 1-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-3-(2,4,6-trichlorophenyl)urea.
| Compound Name | 1-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-3-(2,4,6-trichlorophenyl)urea |
|---|---|
| PubChem CID | 134102372 |
| Molecular Formula | C15H11Cl4N3O2S |
| Molecular Weight | 439.15 g/mol |
| Exact Mass | 436.93 |
| IUPAC Name | 1-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-3-(2,4,6-trichlorophenyl)urea |
| SMILES | O=C(CSc1ccc(Cl)cc1)NNC(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl4N3O2S/c16-8-1-3-10(4-2-8)25-7-13(23)21-22-15(24)20-14-11(18)5-9(17)6-12(14)19/h1-6H,7H2,(H,21,23)(H2,20,22,24) |
| InChIKey | AUDYSAFBSZDIHC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.15 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|