C16H17ClN2O2S2 — CID 26854197
N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-ethyl-5-methylthiophene-2-carbohydrazide (PubChem CID 26854197) has the molecular formula C16H17ClN2O2S2 and a molecular weight of 368.91 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-ethyl-5-methylthiophene-2-carbohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-ethyl-5-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 26854197 |
| Molecular Formula | C16H17ClN2O2S2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-ethyl-5-methylthiophene-2-carbohydrazide |
| SMILES | CCc1cc(C(=O)NNC(=O)CSc2ccc(Cl)cc2)sc1C |
| InChI | InChI=1S/C16H17ClN2O2S2/c1-3-11-8-14(23-10(11)2)16(21)19-18-15(20)9-22-13-6-4-12(17)5-7-13/h4-8H,3,9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | KTWKBCYIPYSBAZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|