C16H17FN2O2S2 — CID 9417913
4-ethyl-N'-[2-(2-fluorophenyl)sulfanylacetyl]-5-methylthiophene-2-carbohydrazide (PubChem CID 9417913) has the molecular formula C16H17FN2O2S2 and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-ethyl-N'-[2-(2-fluorophenyl)sulfanylacetyl]-5-methylthiophene-2-carbohydrazide.
| Compound Name | 4-ethyl-N'-[2-(2-fluorophenyl)sulfanylacetyl]-5-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9417913 |
| Molecular Formula | C16H17FN2O2S2 |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 4-ethyl-N'-[2-(2-fluorophenyl)sulfanylacetyl]-5-methylthiophene-2-carbohydrazide |
| SMILES | CCc1cc(C(=O)NNC(=O)CSc2ccccc2F)sc1C |
| InChI | InChI=1S/C16H17FN2O2S2/c1-3-11-8-14(23-10(11)2)16(21)19-18-15(20)9-22-13-7-5-4-6-12(13)17/h4-8H,3,9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | INKYPAHFCSGSTD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|