C19H28ClN3O3S — CID 56550200
5-[2-[2-(4-chlorophenyl)sulfanylacetyl]hydrazinyl]-5-oxo-N,N-dipropylpentanamide (PubChem CID 56550200) has the molecular formula C19H28ClN3O3S and a molecular weight of 413.97 g/mol. Its IUPAC name is 5-[2-[2-(4-chlorophenyl)sulfanylacetyl]hydrazinyl]-5-oxo-N,N-dipropylpentanamide.
| Compound Name | 5-[2-[2-(4-chlorophenyl)sulfanylacetyl]hydrazinyl]-5-oxo-N,N-dipropylpentanamide |
|---|---|
| PubChem CID | 56550200 |
| Molecular Formula | C19H28ClN3O3S |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 5-[2-[2-(4-chlorophenyl)sulfanylacetyl]hydrazinyl]-5-oxo-N,N-dipropylpentanamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NNC(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H28ClN3O3S/c1-3-12-23(13-4-2)19(26)7-5-6-17(24)21-22-18(25)14-27-16-10-8-15(20)9-11-16/h8-11H,3-7,12-14H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | SZTTZEIDWVITSE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|