C16H24ClNOS — CID 118680080
3-[(4-chlorophenyl)methylsulfanyl]-N,N-dipropylpropanamide (PubChem CID 118680080) has the molecular formula C16H24ClNOS and a molecular weight of 313.89 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfanyl]-N,N-dipropylpropanamide.
| Compound Name | 3-[(4-chlorophenyl)methylsulfanyl]-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 118680080 |
| Molecular Formula | C16H24ClNOS |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfanyl]-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClNOS/c1-3-10-18(11-4-2)16(19)9-12-20-13-14-5-7-15(17)8-6-14/h5-8H,3-4,9-13H2,1-2H3 |
| InChIKey | AFIUTNANSIMLTN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|