C15H13ClN2O3S — CID 35515360
N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-hydroxybenzohydrazide (PubChem CID 35515360) has the molecular formula C15H13ClN2O3S and a molecular weight of 336.80 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-hydroxybenzohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 35515360 |
| Molecular Formula | C15H13ClN2O3S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-hydroxybenzohydrazide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C15H13ClN2O3S/c16-10-5-7-11(8-6-10)22-9-14(20)17-18-15(21)12-3-1-2-4-13(12)19/h1-8,19H,9H2,(H,17,20)(H,18,21) |
| InChIKey | SIDLZAQHXWGMEB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|