C16H15ClN2O3S2 — CID 34056452
N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-oxo-4-thiophen-2-ylbutanehydrazide (PubChem CID 34056452) has the molecular formula C16H15ClN2O3S2 and a molecular weight of 382.89 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-oxo-4-thiophen-2-ylbutanehydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-oxo-4-thiophen-2-ylbutanehydrazide |
|---|---|
| PubChem CID | 34056452 |
| Molecular Formula | C16H15ClN2O3S2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-4-oxo-4-thiophen-2-ylbutanehydrazide |
| SMILES | O=C(CCC(=O)c1cccs1)NNC(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN2O3S2/c17-11-3-5-12(6-4-11)24-10-16(22)19-18-15(21)8-7-13(20)14-2-1-9-23-14/h1-6,9H,7-8,10H2,(H,18,21)(H,19,22) |
| InChIKey | DKZFRINVRADSKV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|