C9H7ClF3NO3S2 — CID 154309569
2-(4-chlorophenyl)sulfanyl-N-(trifluoromethylsulfonyl)acetamide (PubChem CID 154309569) has the molecular formula C9H7ClF3NO3S2 and a molecular weight of 333.74 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(trifluoromethylsulfonyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(trifluoromethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 154309569 |
| Molecular Formula | C9H7ClF3NO3S2 |
| Molecular Weight | 333.74 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(trifluoromethylsulfonyl)acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H7ClF3NO3S2/c10-6-1-3-7(4-2-6)18-5-8(15)14-19(16,17)9(11,12)13/h1-4H,5H2,(H,14,15) |
| InChIKey | OXMNRVIFWOTDKF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.74 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |