C14H13ClN4O4S2 — CID 8860912
N'-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetohydrazide (PubChem CID 8860912) has the molecular formula C14H13ClN4O4S2 and a molecular weight of 400.87 g/mol. Its IUPAC name is N'-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetohydrazide.
| Compound Name | N'-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetohydrazide |
|---|---|
| PubChem CID | 8860912 |
| Molecular Formula | C14H13ClN4O4S2 |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | N'-[(E)-2-(4-chlorophenyl)ethenyl]sulfonyl-2-(4-oxo-2-sulfanylidene-1H-pyrimidin-6-yl)acetohydrazide |
| SMILES | O=C(Cc1cc(=O)[nH]c(=S)[nH]1)NNS(=O)(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H13ClN4O4S2/c15-10-3-1-9(2-4-10)5-6-25(22,23)19-18-13(21)8-11-7-12(20)17-14(24)16-11/h1-7,19H,8H2,(H,18,21)(H2,16,17,20,24)/b6-5+ |
| InChIKey | OKZROKNAAMDOST-AATRIKPKSA-N |
| XLogP | 1.25 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|