C13H18ClNO2S — CID 99918665
(Z)-2-(4-chlorophenyl)-N-pentan-3-ylethenesulfonamide (PubChem CID 99918665) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is (Z)-2-(4-chlorophenyl)-N-pentan-3-ylethenesulfonamide.
| Compound Name | (Z)-2-(4-chlorophenyl)-N-pentan-3-ylethenesulfonamide |
|---|---|
| PubChem CID | 99918665 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (Z)-2-(4-chlorophenyl)-N-pentan-3-ylethenesulfonamide |
| SMILES | CCC(CC)NS(=O)(=O)/C=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO2S/c1-3-13(4-2)15-18(16,17)10-9-11-5-7-12(14)8-6-11/h5-10,13,15H,3-4H2,1-2H3/b10-9- |
| InChIKey | JPQMQXQGYXBZGS-KTKRTIGZSA-N |
| XLogP | 3.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |