C12H12ClNO6S — CID 78907343
2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]butanedioic acid (PubChem CID 78907343) has the molecular formula C12H12ClNO6S and a molecular weight of 333.75 g/mol. Its IUPAC name is 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]butanedioic acid.
| Compound Name | 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]butanedioic acid |
|---|---|
| PubChem CID | 78907343 |
| Molecular Formula | C12H12ClNO6S |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]butanedioic acid |
| SMILES | O=C(O)CC(NS(=O)(=O)/C=C/c1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C12H12ClNO6S/c13-9-3-1-8(2-4-9)5-6-21(19,20)14-10(12(17)18)7-11(15)16/h1-6,10,14H,7H2,(H,15,16)(H,17,18)/b6-5+ |
| InChIKey | MJMWEXWUYMRIGB-AATRIKPKSA-N |
| XLogP | 1.16 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |